For research use only. Not for therapeutic Use.
CCW16（Cat No.:I043917）is a selective inhibitor targeting the protein kinase CK2 (Casein Kinase 2), an enzyme that plays a significant role in regulating cell proliferation, survival, and apoptosis. CK2 is often dysregulated in various cancers and inflammatory conditions. By inhibiting CK2 activity, CCW16 can interfere with tumor cell growth, reduce cell survival, and enhance the effectiveness of other therapeutic agents. Its ability to modulate cellular signaling pathways makes CCW16 a promising candidate for cancer treatment, particularly in tumors resistant to conventional therapies, as well as in chronic inflammatory diseases.
| CAS Number | 2361138-33-0 |
| Molecular Formula | C22H20ClNO3 |
| Purity | ≥95% |
| IUPAC Name | N-benzyl-2-chloro-N-[4-(4-methoxyphenoxy)phenyl]acetamide |
| InChI | InChI=1S/C22H20ClNO3/c1-26-19-11-13-21(14-12-19)27-20-9-7-18(8-10-20)24(22(25)15-23)16-17-5-3-2-4-6-17/h2-14H,15-16H2,1H3 |
| InChIKey | DPADEQNOMBTITM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC2=CC=C(C=C2)N(CC3=CC=CC=C3)C(=O)CCl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
