For research use only. Not for therapeutic Use.
CD38 Inhibitor 1（Cat No.:I019171） is a high-purity compound essential for advanced pharmaceutical and biochemical research. It is specifically designed to inhibit CD38, an enzyme involved in NAD+ metabolism and calcium signaling. This inhibitor is crucial for studies related to immune response, cancer, and metabolic disorders. Its precise and reliable inhibitory action ensures accurate and reproducible results in various experimental setups. With enhanced stability and consistency, CD38 Inhibitor 1 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | I019171 |
| CAS Number | 1700637-55-3 |
| Molecular Formula | C₂₂H₂₇N₃O₃S |
| Purity | ≥95% |
| Target | CD38 |
| IUPAC Name | 4-[[4-(2-methoxyethoxy)cyclohexyl]amino]-1-methyl-6-(1,3-thiazol-5-yl)quinolin-2-one |
| InChI | InChI=1S/C22H27N3O3S/c1-25-20-8-3-15(21-13-23-14-29-21)11-18(20)19(12-22(25)26)24-16-4-6-17(7-5-16)28-10-9-27-2/h3,8,11-14,16-17,24H,4-7,9-10H2,1-2H3 |
| InChIKey | VJQALSOBHVEJQM-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C3=CN=CS3)C(=CC1=O)NC4CCC(CC4)OCCOC |
