For research use only. Not for therapeutic Use.
CDK-IN-2（Cat No.:I001080）is a potent and selective cyclin-dependent kinase (CDK) inhibitor that plays a crucial role in cell cycle regulation and cancer research. By inhibiting CDKs, it prevents the phosphorylation of key substrates required for cell cycle progression, leading to cell cycle arrest and apoptosis in cancer cells. CDK-IN-2 is valuable for studying cancer cell proliferation, tumor growth, and the development of novel cancer therapies. It is widely used in pharmaceutical research to explore targeted cancer treatments and understand the molecular mechanisms underlying cell cycle control.
| Catalog Number | I001080 |
| CAS Number | 1269815-17-9 |
| Synonyms | (3R)-N-[5-chloro-4-(5-fluoro-2-methoxyphenyl)pyridin-2-yl]piperidine-3-carboxamide |
| Molecular Formula | C18H19ClFN3O2 |
| Purity | ≥95% |
| Target | Cyclin-Dependent Kinases |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IC50 | <8 nM [1] |
| IUPAC Name | (3R)-N-[5-chloro-4-(5-fluoro-2-methoxyphenyl)pyridin-2-yl]piperidine-3-carboxamide |
| InChI | InChI=1S/C18H19ClFN3O2/c1-25-16-5-4-12(20)7-14(16)13-8-17(22-10-15(13)19)23-18(24)11-3-2-6-21-9-11/h4-5,7-8,10-11,21H,2-3,6,9H2,1H3,(H,22,23,24)/t11-/m1/s1 |
| InChIKey | AHMKHNVZGOQLRQ-LLVKDONJSA-N |
| SMILES | COC1=C(C=C(C=C1)F)C2=CC(=NC=C2Cl)NC(=O)[C@@H]3CCCNC3 |
| Reference | <p style=/line-height:25px/> |
