For research use only. Not for therapeutic Use.
CDK1/2 Inhibitor III (Cat No.:I011563) is a small molecule inhibitor that targets the Cyclin-dependent kinases (CDK) 1 and 2, which play a crucial role in cell cycle regulation and cell division. By inhibiting CDK1/2 activity, this inhibitor can arrest cell cycle progression and prevent cancer cells from dividing, making it a potential therapeutic agent for cancer treatment. CDK1/2 Inhibitor III works by binding to the ATP-binding site of CDK1/2 and blocking its kinase activity, leading to cell cycle arrest and apoptosis. It has been studied for its potential therapeutic applications in various types of cancer, including breast cancer, ovarian cancer, and leukemia. Additionally, CDK1/2 Inhibitor III has also been investigated for its potential to enhance the efficacy of other anticancer therapies, such as chemotherapy and radiation therapy.
Catalog Number | I011563 |
CAS Number | 443798-47-8 |
Synonyms | 5-amino-3-[[4-(aminosulfonyl)phenyl]amino]-N-(2,6-difluorophenyl)-1H-1,2,4-triazole-1-carbothioamide |
Molecular Formula | C15H13F2N7O2S2 |
Purity | ≥95% |
Target | Protein Tyrosine Kinase/RTK |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | 5-amino-N-(2,6-difluorophenyl)-3-(4-sulfamoylanilino)-1,2,4-triazole-1-carbothioamide |
InChI | InChI=1S/C15H13F2N7O2S2/c16-10-2-1-3-11(17)12(10)21-15(27)24-13(18)22-14(23-24)20-8-4-6-9(7-5-8)28(19,25)26/h1-7H,(H,21,27)(H2,19,25,26)(H3,18,20,22,23) |
InChIKey | ARIOBGGRZJITQX-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)F)NC(=S)N2C(=NC(=N2)NC3=CC=C(C=C3)S(=O)(=O)N)N)F |