For research use only. Not for therapeutic Use.
CDK4/6-IN-2(Cat No.:I019064)is a selective inhibitor targeting cyclin-dependent kinases 4 and 6 (CDK4/6), which are crucial for regulating the cell cycle, particularly the G1 phase transition. By inhibiting these kinases, CDK4/6-IN-2 effectively halts cancer cell proliferation and induces apoptosis, making it a valuable candidate in cancer therapy. This compound is primarily investigated for its potential in treating hormone receptor-positive breast cancer, often in combination with endocrine therapies. Preclinical studies have demonstrated its efficacy in reducing tumor growth, and ongoing research aims to optimize its clinical application in various malignancies.
Catalog Number | I019064 |
CAS Number | 1800506-48-2 |
Molecular Formula | C₂₇H₃₂F₂N₈ |
Purity | ≥95% |
Target | CDK |
IUPAC Name | 5-[(4-ethylpiperazin-1-yl)methyl]-N-[5-fluoro-4-(7-fluoro-2-methyl-3-propan-2-ylbenzimidazol-5-yl)pyridin-2-yl]pyrimidin-2-amine |
InChI | InChI=1S/C27H32F2N8/c1-5-35-6-8-36(9-7-35)16-19-13-31-27(32-14-19)34-25-12-21(23(29)15-30-25)20-10-22(28)26-24(11-20)37(17(2)3)18(4)33-26/h10-15,17H,5-9,16H2,1-4H3,(H,30,31,32,34) |
InChIKey | CMOYPFUEZDEQEH-UHFFFAOYSA-N |
SMILES | CCN1CCN(CC1)CC2=CN=C(N=C2)NC3=NC=C(C(=C3)C4=CC5=C(C(=C4)F)N=C(N5C(C)C)C)F |
Reference | [1]. Frank Wu, et al. Kinase inhibitor and use thereof. US20180000819A1. |