For research use only. Not for therapeutic Use.
CDK7-IN-21(Cat No.:I041168)is a selective small molecule inhibitor that targets CDK7 (cyclin-dependent kinase 7), a key enzyme in the regulation of transcription and cell cycle progression. CDK7 is a component of the Mediator complex and is involved in phosphorylating RNA polymerase II, a crucial step in gene expression. By inhibiting CDK7, CDK7-IN-21 disrupts transcriptional activity, leading to cell cycle arrest and apoptosis in rapidly dividing cells, such as cancer cells. This compound is being studied for its potential in treating cancers, including breast cancer and other malignancies driven by dysregulated transcription and cell cycle control.
CAS Number | 2766124-39-2 |
Synonyms | 2-fluoro-N-[1-[2-[[[2-[[(3R,4R)-3-hydroxypiperidin-4-yl]methylamino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]isoquinolin-6-yl]prop-2-enamide |
Molecular Formula | C33H36FN9O2 |
Purity | ≥95% |
IUPAC Name | 2-fluoro-N-[1-[2-[[[2-[[(3R,4R)-3-hydroxypiperidin-4-yl]methylamino]-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]isoquinolin-6-yl]prop-2-enamide |
InChI | InChI=1S/C33H36FN9O2/c1-19(2)27-17-39-43-30(27)41-32(37-16-23-10-12-35-18-28(23)44)42-33(43)38-15-22-6-4-5-7-25(22)29-26-9-8-24(40-31(45)20(3)34)14-21(26)11-13-36-29/h4-9,11,13-14,17,19,23,28,35,44H,3,10,12,15-16,18H2,1-2H3,(H,40,45)(H2,37,38,41,42)/t23-,28+/m1/s1 |
InChIKey | PDKSTEKFCWNJFC-LXFBAYGMSA-N |
SMILES | CC(C)C1=C2N=C(N=C(N2N=C1)NCC3=CC=CC=C3C4=NC=CC5=C4C=CC(=C5)NC(=O)C(=C)F)NC[C@H]6CCNC[C@@H]6O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |