For research use only. Not for therapeutic Use.
CDK8-IN-13（Cat No.:I041187）is an investigational small molecule inhibitor designed to target cyclin-dependent kinase 8 (CDK8), a key regulator of transcriptional processes involved in cell cycle progression and gene expression. By inhibiting CDK8, this compound aims to disrupt aberrant gene expression that contributes to cancer cell proliferation and survival. CDK8-IN-13 shows potential in treating various cancers, including those with mutations in the Wnt signaling pathway, which is often dysregulated in tumors. Ongoing clinical trials are evaluating its safety, efficacy, and therapeutic potential as part of targeted cancer therapies.
| CAS Number | 918523-75-8 |
| Synonyms | 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzamide |
| Molecular Formula | C14H11N3O |
| Purity | ≥95% |
| IUPAC Name | 3-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzamide |
| InChI | InChI=1S/C14H11N3O/c15-13(18)10-3-1-2-9(6-10)12-7-11-4-5-16-14(11)17-8-12/h1-8H,(H2,15,18)(H,16,17) |
| InChIKey | PQAJMNITAQGSCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)N)C2=CN=C3C(=C2)C=CN3 |
