For research use only. Not for therapeutic Use.
CDK8-IN-4(Cat No.:I020099)is a selective small-molecule inhibitor of cyclin-dependent kinase 8 (CDK8), a kinase involved in transcription regulation and cellular processes like cell cycle progression and differentiation. CDK8 plays a crucial role in mediating the activity of the transcriptional mediator complex, which is essential for gene expression. By inhibiting CDK8, CDK8-IN-4 can modulate transcription and has shown potential in preclinical studies for treating cancer and inflammatory diseases. Its effects on cell cycle regulation and transcriptional pathways make it a promising target for drug development in oncology and other disorders.
Catalog Number | I020099 |
CAS Number | 1613638-82-6 |
Molecular Formula | C₂₀H₁₈N₄O |
Purity | ≥95% |
Target | CDK |
IUPAC Name | (2R)-2-[[5-(1H-indazol-5-yl)pyridin-3-yl]amino]-2-phenylethanol |
InChI | InChI=1S/C20H18N4O/c25-13-20(14-4-2-1-3-5-14)23-18-9-16(10-21-12-18)15-6-7-19-17(8-15)11-22-24-19/h1-12,20,23,25H,13H2,(H,22,24)/t20-/m0/s1 |
InChIKey | VFKCKMKPKIUZOF-FQEVSTJZSA-N |
SMILES | C1=CC=C(C=C1)[C@H](CO)NC2=CN=CC(=C2)C3=CC4=C(C=C3)NN=C4 |