For research use only. Not for therapeutic Use.
CDK9-IN-2（Cat No.:I001062）is a selective inhibitor of cyclin-dependent kinase 9 (CDK9), a key regulator of transcription elongation. By targeting CDK9, this compound disrupts the interaction between CDK9 and its partner cyclin T1, leading to decreased phosphorylation of the C-terminal domain of RNA polymerase II. This inhibition can reduce the expression of various oncogenes, making CDK9-IN-2 a potential therapeutic agent in cancer treatment. Research has shown its effectiveness in preclinical models, highlighting its promise in overcoming resistance mechanisms in certain cancers.
| Catalog Number | I001062 |
| CAS Number | 1263369-28-3 |
| Synonyms | 4-N-[5-chloro-4-[6-[(3-fluorophenyl)methylamino]pyridin-2-yl]pyridin-2-yl]cyclohexane-1,4-diamine |
| Molecular Formula | C23H25ClFN5 |
| Purity | ≥95% |
| Target | Cyclin-Dependent Kinases |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 4-N-[5-chloro-4-[6-[(3-fluorophenyl)methylamino]pyridin-2-yl]pyridin-2-yl]cyclohexane-1,4-diamine |
| InChI | InChI=1S/C23H25ClFN5/c24-20-14-28-23(29-18-9-7-17(26)8-10-18)12-19(20)21-5-2-6-22(30-21)27-13-15-3-1-4-16(25)11-15/h1-6,11-12,14,17-18H,7-10,13,26H2,(H,27,30)(H,28,29) |
| InChIKey | XKHXPTSUVPZYDW-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1N)NC2=NC=C(C(=C2)C3=NC(=CC=C3)NCC4=CC(=CC=C4)F)Cl |
| Reference | <p style=/line-height:25px/> |
