For research use only. Not for therapeutic Use.
Cediranib maleate（Cat No.:I005145）is a potent, selective inhibitor of vascular endothelial growth factor receptors (VEGFR-1, VEGFR-2, and VEGFR-3), which are crucial for angiogenesis and tumor growth. By blocking VEGF signaling, Cediranib disrupts blood vessel formation, inhibiting tumor proliferation and metastasis. This compound is primarily studied for its anti-cancer properties, particularly in solid tumors such as ovarian cancer, glioblastoma, and colorectal cancer. Its ability to impair tumor vasculature makes Cediranib a valuable tool in cancer research, particularly in the development of targeted anti-angiogenic therapies.
| Catalog Number | I005145 |
| CAS Number | 857036-77-2 |
| Synonyms | AZD-2171 maleate |
| Molecular Formula | C29H31FN4O7 |
| Purity | ≥95% |
| Target | VEGFR2; Flt1/4 |
| Solubility | DMSO: ≥ 45 mg/mL |
| Storage | Store at -20°C |
| IC50 | 0.5 nM (VEGFR2); 5 nM/≤3 nM(Flt1/4) |
| IUPAC Name | (Z)-but-2-enedioic acid;4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazoline |
| InChI | InChI=1S/C25H27FN4O3.C4H4O4/c1-16-12-17-19(29-16)6-7-21(24(17)26)33-25-18-13-22(31-2)23(14-20(18)27-15-28-25)32-11-5-10-30-8-3-4-9-30;5-3(6)1-2-4(7)8/h6-7,12-15,29H,3-5,8-11H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | JRMGHBVACUJCRP-BTJKTKAUSA-N |
| SMILES | CC1=CC2=C(N1)C=CC(=C2F)OC3=NC=NC4=CC(=C(C=C43)OC)OCCCN5CCCC5.C(=C\C(=O)O)\C(=O)O |
| Reference | <p> |
