For research use only. Not for therapeutic Use.
Cefathiamidine(Cat No.:R040447), is a cephalosporin antibiotic. It belongs to the second-generation cephalosporin class and is used to treat various bacterial infections. Cefathiamidine is effective against a wide range of Gram-positive and Gram-negative bacteria, making it valuable in clinical settings. As an antibiotic, it works by interfering with bacterial cell wall synthesis, leading to the disruption of bacterial growth and ultimately causing bacterial cell death. Its pharmaceutical application makes it a useful option in combating bacterial infections in humans.
CAS Number | 33075-00-2 |
Synonyms | (6R-trans)-3-[(Acetyloxy)methyl]-7-[[[[[(1-methylethyl)amino][(1-methylethyl)imino]methyl]thio]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic Acid; 7-[2-[(N,N’-diisopropylamidino)thio]acetamido]-3-(hydroxymethyl)-8-oxo-5-thia-1- |
Molecular Formula | C19H28N4O6S2 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | (6R,7R)-3-(acetyloxymethyl)-7-[[2-[N,N/'-di(propan-2-yl)carbamimidoyl]sulfanylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
InChI | InChI=1S/C19H28N4O6S2/c1-9(2)20-19(21-10(3)4)31-8-13(25)22-14-16(26)23-15(18(27)28)12(6-29-11(5)24)7-30-17(14)23/h9-10,14,17H,6-8H2,1-5H3,(H,20,21)(H,22,25)(H,27,28)/t14-,17-/m1/s1 |
InChIKey | JYXACOFERDBGGQ-RHSMWYFYSA-N |
SMILES | CC(C)NC(=NC(C)C)SCC(=O)NC1C2N(C1=O)C(=C(CS2)COC(=O)C)C(=O)O |