For research use only. Not for therapeutic Use.
Cefazolin Amide is a derivative of cefazolin, a first-generation cephalosporin antibiotic known for its broad-spectrum antibacterial activity. This modified form retains the core β-lactam structure essential for inhibiting bacterial cell wall synthesis, making it effective against various Gram-positive and some Gram-negative bacteria. The amide modification may enhance pharmacokinetic properties, improving stability and bioavailability. Cefazolin is commonly used in surgical prophylaxis and treating infections such as skin and soft tissue infections, respiratory tract infections, and urinary tract infections. Research into Cefazolin Amide focuses on optimizing its therapeutic efficacy and exploring its potential applications in combating antibiotic resistance.
Catalog Number | R048799 |
CAS Number | 1322626-65-2 |
Synonyms | (6R,7R)-3-[[(5-Methyl-1,3,4-thiadiazol-2-yl)thio]methyl]-8-oxo-7-[(1H-tetrazol-1-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxamide; |
Molecular Formula | C14H15N9O3S3 |
Purity | ≥95% |
Storage | -20 ℃ |
IUPAC Name | (7R)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-7-[[2-(tetrazol-1-yl)acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxamide |
InChI | InChI=1S/C14H15N9O3S3/c1-6-18-19-14(29-6)28-4-7-3-27-13-9(12(26)23(13)10(7)11(15)25)17-8(24)2-22-5-16-20-21-22/h5,9,13H,2-4H2,1H3,(H2,15,25)(H,17,24)/t9-,13?/m1/s1 |
InChIKey | UJXOAWOOZVMQQR-CGCSKFHYSA-N |
SMILES | CC1=NN=C(S1)SCC2=C(N3C(C(C3=O)NC(=O)CN4C=NN=N4)SC2)C(=O)N |