For research use only. Not for therapeutic Use.
Cefeprime dihydrochloride(Cat No.:M006861) is a pharmaceutical compound belonging to the cephalosporin antibiotic class. Its mode of action involves inhibiting bacterial cell wall synthesis, leading to the disruption of bacterial growth and ultimately causing cell death. Cefeprime dihydrochloride exhibits potent antibacterial properties, making it effective against a wide range of gram-positive and gram-negative bacteria. Due to its efficacy and safety profile, it is commonly used in the treatment of various bacterial infections, such as respiratory tract infections, skin and soft tissue infections, and urinary tract infections.
CAS Number | 107648-80-6 |
Molecular Formula | C19H24N6O5S2.2ClH |
Purity | ≥95% |
Target | Antibiotic |
Storage | -80°C |
IUPAC Name | (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;chloride;hydrochloride |
InChI | InChI=1S/C19H24N6O5S2.2ClH/c1-25(5-3-4-6-25)7-10-8-31-17-13(16(27)24(17)14(10)18(28)29)22-15(26)12(23-30-2)11-9-32-19(20)21-11;;/h9,13,17H,3-8H2,1-2H3,(H3-,20,21,22,26,28,29);2*1H/b23-12-;;/t13-,17-;;/m1../s1 |
InChIKey | XQQAUWFZBOTKFQ-MHRNPJSASA-N |
SMILES | C[N+]1(CCCC1)CC2=C(N3[C@@H]([C@@H](C3=O)NC(=O)/C(=N\OC)/C4=CSC(=N4)N)SC2)C(=O)O.Cl.[Cl-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |