For research use only. Not for therapeutic Use.
Cefoselis（Cat No.:I000887）is a broad-spectrum cephalosporin antibiotic used to treat bacterial infections. It works by inhibiting bacterial cell wall synthesis, causing cell lysis and death. Cefoselis is effective against both Gram-positive and Gram-negative bacteria, making it useful in managing infections such as pneumonia, skin infections, and urinary tract infections. As a semi-synthetic cephalosporin, it has improved resistance to β-lactamase enzymes compared to earlier generations. Cefoselis is commonly administered intravenously or intramuscularly in clinical settings, with dosing determined by the infection type and patient condition.
| CAS Number | 122841-10-5 |
| Synonyms | (6R,7R)-3-[[3-amino-2-(2-hydroxyethyl)pyrazol-1-ium-1-yl]methyl]-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| Molecular Formula | C19H22N8O6S2 |
| Purity | ≥95% |
| Target | Bacterial |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20C |
| IUPAC Name | (6R,7R)-3-[[3-amino-2-(2-hydroxyethyl)pyrazol-1-ium-1-yl]methyl]-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| InChI | InChI=1S/C19H22N8O6S2/c1-33-24-12(10-8-35-19(21)22-10)15(29)23-13-16(30)27-14(18(31)32)9(7-34-17(13)27)6-25-3-2-11(20)26(25)4-5-28/h2-3,8,13,17,20,28H,4-7H2,1H3,(H4,21,22,23,29,31,32)/b24-12-/t13-,17-/m1/s1 |
| InChIKey | BHXLLRXDAYEMPP-SBGRAJFYSA-N |
| SMILES | CO/N=C(/C1=CSC(=N1)N)\C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C[N+]4=CC=C(N4CCO)N)C(=O)[O-] |
| Reference | <p style=/line-height:25px/> |
