For research use only. Not for therapeutic Use.
Cefozopran(Cat No.:I000502)is a fourth-generation cephalosporin antibiotic with broad-spectrum efficacy against both Gram-positive and Gram-negative bacteria, including Pseudomonas aeruginosa. It inhibits bacterial cell wall synthesis by targeting penicillin-binding proteins, leading to cell lysis and death. Cefozopran is primarily used in treating severe infections, such as respiratory, urinary tract, and intra-abdominal infections, where resistant strains are a concern. Known for its stability against many beta-lactamases, it remains effective against extended-spectrum beta-lactamase (ESBL)-producing bacteria. Cefozopran’s broad activity makes it valuable in hospital settings for managing complex infections.
CAS Number | 113359-04-9 |
Molecular Formula | C19H17N9O5S2 |
Purity | ≥95% |
Target | Bacterial |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IUPAC Name | (6R,7R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-(imidazo[1,2-b]pyridazin-1-ium-1-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
InChI | InChI=1S/C19H17N9O5S2/c1-33-24-11(14-23-19(20)35-25-14)15(29)22-12-16(30)28-13(18(31)32)9(8-34-17(12)28)7-26-5-6-27-10(26)3-2-4-21-27/h2-6,12,17H,7-8H2,1H3,(H3-,20,22,23,25,29,31,32)/b24-11-/t12-,17-/m1/s1 |
InChIKey | QDUIJCOKQCCXQY-WHJQOFBOSA-N |
SMILES | CO/N=C(/C1=NSC(=N1)N)\C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C[N+]4=C5C=CC=NN5C=C4)C(=O)[O-] |
Reference | 1: Guo WW, Shen Q, Qin YP, Wang Y, Wang L, Miao J, Nan F, Xiang J, Yu Q, Liang 2: Kataoka D, Tanaka Y. The combination of aztreonam and cefozopran against <br> <br> |