For research use only. Not for therapeutic Use.
Cefpodoxime proxetil (Cat No.:I012097) is an orally administered prodrug of cefpodoxime, a third-generation cephalosporin antibiotic. It exhibits a broad-spectrum antibacterial activity against both Gram-positive and Gram-negative bacteria. Cefpodoxime works by inhibiting bacterial cell wall synthesis through binding to specific penicillin-binding proteins (PBPs). This disrupts the integrity of the bacterial cell wall and leads to cell death. Cefpodoxime proxetil is commonly prescribed to treat various bacterial infections, including respiratory tract infections, urinary tract infections, skin and soft tissue infections, and certain sexually transmitted infections.
| Catalog Number | I012097 |
| CAS Number | 87239-81-4 |
| Synonyms | (6R,7R)-7-[[(2Z)-2-(2-Amino-4-thiazolyl)-2-(methoxyimino)acetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic Acid 1-[[(1-Methylethoxy)carbonyl]oxy]ethyl Ester; Antibiotic CS 807; Banan; CS 807; Cefodox; Cefoprox; Ce |
| Molecular Formula | C21H27N5O9S2 |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | -80°C |
| IUPAC Name | 1-propan-2-yloxycarbonyloxyethyl (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| InChI | InChI=1S/C21H27N5O9S2/c1-9(2)33-21(30)35-10(3)34-19(29)15-11(6-31-4)7-36-18-14(17(28)26(15)18)24-16(27)13(25-32-5)12-8-37-20(22)23-12/h8-10,14,18H,6-7H2,1-5H3,(H2,22,23)(H,24,27)/b25-13-/t10?,14-,18-/m1/s1 |
| InChIKey | LTINZAODLRIQIX-FBXRGJNPSA-N |
| SMILES | CC(C)OC(=O)OC(C)OC(=O)C1=C(CS[C@H]2N1C(=O)[C@H]2NC(=O)/C(=N\OC)/C3=CSC(=N3)N)COC |
| Reference | <br /> |
