For research use only. Not for therapeutic Use.
Ceftezole(Cat No.:R035783)is a first-generation cephalosporin antibiotic primarily used to treat bacterial infections, especially those involving Gram-positive organisms. It works by inhibiting bacterial cell wall synthesis, leading to cell death, making it effective against conditions like skin infections, respiratory tract infections, and urinary tract infections. Ceftezole is valued for its stability against certain bacterial beta-lactamases, although its spectrum of activity is limited compared to later-generation cephalosporins. Its safety profile and efficacy in treating susceptible bacterial infections make ceftezole a reliable option in clinical settings, particularly for less severe infections.
Catalog Number | R035783 |
CAS Number | 26973-24-0 |
Synonyms | (6R,7R)-8-Oxo-7-[[2-(1H-tetrazol-1-yl)acetyl]amino]-3-[(1,3,4-thiadiazol-2-ylthio)methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic Acid; CG-B 3Q; CTZ; Ceftezol; FR 10123; (6R,7R)-3-(((1,3,4-thiadiazol-2-yl)thio)methyl)-7-(2-(1H-tetrazol-1-yl) |
Molecular Formula | C13H12N8O4S3 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | (6R,7R)-8-oxo-7-[[2-(tetrazol-1-yl)acetyl]amino]-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
InChI | InChI=1S/C13H12N8O4S3/c22-7(1-20-4-14-18-19-20)16-8-10(23)21-9(12(24)25)6(2-26-11(8)21)3-27-13-17-15-5-28-13/h4-5,8,11H,1-3H2,(H,16,22)(H,24,25)/t8-,11-/m1/s1 |
InChIKey | DZMVCVMFETWNIU-LDYMZIIASA-N |
SMILES | C1C(=C(N2[C@H](S1)[C@@H](C2=O)NC(=O)CN3C=NN=N3)C(=O)O)CSC4=NN=CS4 |