For research use only. Not for therapeutic Use.
Ceftriaxone-d3 disodium(Cat No.:S000268) is a deuterated form of ceftriaxone disodium, where three hydrogen atoms are replaced with deuterium, enhancing its molecular stability. This modification makes it particularly valuable as an internal standard for analytical methods such as mass spectrometry and NMR spectroscopy. Ceftriaxone is a broad-spectrum cephalosporin antibiotic used extensively to treat infections like pneumonia, meningitis, and sepsis. By incorporating deuterium, ceftriaxone-d3 disodium facilitates more accurate and detailed pharmacokinetic and metabolic studies, allowing researchers to better understand the drug’s behavior, particularly its absorption, distribution, metabolism, and excretion processes.
Catalog Number | S000268 |
CAS Number | 1132650-38-4 |
Molecular Formula | C18H14D3N8Na2O7S3 |
Purity | ≥95% |
Target | Bacterial |
IUPAC Name | (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(trideuteriomethoxyimino)acetyl]amino]-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
InChI | InChI=1S/C18H18N8O7S3/c1-25-18(22-12(28)13(29)23-25)36-4-6-3-34-15-9(14(30)26(15)10(6)16(31)32)21-11(27)8(24-33-2)7-5-35-17(19)20-7/h5,9,15H,3-4H2,1-2H3,(H2,19,20)(H,21,27)(H,23,29)(H,31,32)/b24-8-/t9-,15-/m1/s1/i2D3 |
InChIKey | VAAUVRVFOQPIGI-SBUQEZGDSA-N |
SMILES | CN1C(=NC(=O)C(=O)N1)SCC2=C(N3C(C(C3=O)NC(=O)C(=NOC)C4=CSC(=N4)N)SC2)C(=O)O |