For research use only. Not for therapeutic Use.
Cefuroxime-d3 is a deuterated form of cefuroxime, a second-generation cephalosporin antibiotic used to treat various bacterial infections. The incorporation of three deuterium atoms into the molecule enhances its stability and makes it particularly valuable for pharmacokinetic studies, drug metabolism research, and isotope-labeled experiments. Cefuroxime-d3 is essential in studying the absorption, distribution, metabolism, and excretion (ADME) of cefuroxime in biological systems. This isotopically labeled compound is also useful as an internal standard in mass spectrometry, ensuring precise and accurate analytical results in pharmaceutical research and development.
Catalog Number | R007957 |
CAS Number | NA |
Synonyms | (6R,7R)-3-[[(Aminocarbonyl)oxy]methyl]-7-[[(2Z)-2-furanyl(methoxy-d3-imino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic Acid; |
Molecular Formula | C₁₆H₁₃D₃N₄O₈S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (6R,7R)-3-(carbamoyloxymethyl)-7-[[(2E)-2-(furan-2-yl)-2-(trideuteriomethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
InChI | InChI=1S/C16H16N4O8S/c1-26-19-9(8-3-2-4-27-8)12(21)18-10-13(22)20-11(15(23)24)7(5-28-16(17)25)6-29-14(10)20/h2-4,10,14H,5-6H2,1H3,(H2,17,25)(H,18,21)(H,23,24)/b19-9+/t10-,14-/m1/s1/i1D3 |
InChIKey | JFPVXVDWJQMJEE-RULOFTGVSA-N |
SMILES | [2H]C([2H])([2H])O/N=C(\C1=CC=CO1)/C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)COC(=O)N)C(=O)O |