For research use only. Not for therapeutic Use.
Celecoxib (Cat No.: A001201) is a selective COX-2 inhibitor, widely used for managing pain and inflammation associated with conditions like arthritis. By targeting cyclooxygenase-2, it reduces prostaglandin synthesis, providing anti-inflammatory, analgesic, and antipyretic effects while minimizing gastrointestinal side effects typical of non-selective NSAIDs. Celecoxib is also explored for its potential in cancer therapy, particularly in reducing tumor growth and metastasis. It plays a key role in managing chronic pain and inflammatory disorders, offering effective symptom relief with a favorable safety profile.
| CAS Number | 169590-42-5 |
| Synonyms | C 58635 |
| Molecular Formula | C₁₇H₁₄F₃N₃O₂S |
| Purity | ≥95% |
| Target | COX |
| Solubility | >19.1mg/mL in DMSO |
| Storage | store at -20 ℃ |
| IUPAC Name | 4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| InChI | InChI=1S/C17H14F3N3O2S/c1-11-2-4-12(5-3-11)15-10-16(17(18,19)20)22-23(15)13-6-8-14(9-7-13)26(21,24)25/h2-10H,1H3,(H2,21,24,25) |
| InChIKey | RZEKVGVHFLEQIL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)N)C(F)(F)F |
