For research use only. Not for therapeutic Use.
Cellobionic acid is a sugar acid derived from the oxidation of cellobiose, a disaccharide of glucose. It is utilized in various biotechnological applications, particularly in enzymatic processes for the production of biofuels and biochemicals from cellulose. Its unique chemical properties make it valuable as a substrate for microbial fermentation and enzymatic conversion, contributing to the development of sustainable processes for biomass utilization.
| Catalog Number | R035106 |
| CAS Number | 534-41-8 |
| Synonyms | 4-O-β-D-Glucopyranosyl-D-gluconic Acid; |
| Molecular Formula | C12H22O12 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanoic acid |
| InChI | InChI=1S/C12H22O12/c13-1-3(15)10(7(18)8(19)11(21)22)24-12-9(20)6(17)5(16)4(2-14)23-12/h3-10,12-20H,1-2H2,(H,21,22)/t3-,4-,5-,6+,7-,8-,9-,10-,12+/m1/s1 |
| InChIKey | JYTUSYBCFIZPBE-ZNLUKOTNSA-N |
| SMILES | C(C1C(C(C(C(O1)OC(C(CO)O)C(C(C(=O)O)O)O)O)O)O)O |
