For research use only. Not for therapeutic Use.
Cellulose triacetate(CAT: R065294) is a highly acetylated derivative of cellulose, where approximately all of the hydroxyl groups of the cellulose polymer are replaced by acetate groups. This modification results in a material with unique properties, including high clarity, excellent dimensional stability, and resistance to moisture and various chemicals. Cellulose triacetate is widely used in the production of photographic films, membranes, and textiles. Its optical clarity and durability make it ideal for high-quality film bases and lenses. Additionally, it is used in various filtration applications due to its ability to form selective and stable membranes. In research, cellulose triacetate is often employed in studies related to polymer science, material engineering, and applications requiring high-performance, biocompatible materials.
CAS Number | 9012-09-3 |
Synonyms | Triacetylcellulose |
Molecular Formula | C40H54O27 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2R,3R,4S,5R,6S)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate |
InChI | InChI=1S/C40H54O27/c1-15(41)52-12-26-29(55-18(4)44)32(56-19(5)45)36(60-23(9)49)39(64-26)67-31-28(14-54-17(3)43)65-40(37(61-24(10)50)34(31)58-21(7)47)66-30-27(13-53-16(2)42)63-38(62-25(11)51)35(59-22(8)48)33(30)57-20(6)46/h26-40H,12-14H2,1-11H3/t26-,27-,28-,29-,30-,31-,32+,33+,34+,35-,36-,37-,38-,39+,40+/m1/s1 |
InChIKey | NNLVGZFZQQXQNW-ADJNRHBOSA-N |
SMILES | CC(=O)OCC1C(C(C(C(O1)OC2C(OC(C(C2OC(=O)C)OC(=O)C)OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C)OC3C(C(C(C(O3)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Reference | 1.Sunohara, T., and Masuda, T. Cellulose triacetate as a high-performance membrane. Contrib.Nephrol. 173, 156-163 (2011). |