For research use only. Not for therapeutic Use.
CeMMEC13 is an isoquinolinone that selectively inhibits the second bromodomain of TAF1 (IC<sub>50</sub> = 2.1 µM). It does not bind to bromodomains of BRD4, BRD9, or CREBBP. CeMMEC13 synergizes with (+)-JQ1 (Item No. <span class=/itemid/>11187</span>) to inhibit the proliferation of THP-1 and H23 lung adenocarcinoma cells.
| Catalog Number | R066724 |
| CAS Number | 1790895-25-8 |
| Synonyms | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2-dihydro-1-methyl-2-oxo-4-quinolinecarboxamide |
| Molecular Formula | C19H16N2O4 |
| Purity | ≥95% |
| Target | DNA/RNA Synthesis |
| Storage | -20°C |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-methyl-2-oxoquinoline-4-carboxamide |
| InChI | InChI=1S/C19H16N2O4/c1-21-15-5-3-2-4-13(15)14(11-18(21)22)19(23)20-12-6-7-16-17(10-12)25-9-8-24-16/h2-7,10-11H,8-9H2,1H3,(H,20,23) |
| InChIKey | NXKBPGZQDHACPZ-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=CC1=O)C(=O)NC3=CC4=C(C=C3)OCCO4 |
| Reference | 1.Sdelci, S.,Lardeau, C.H.,Tallant, C., et al. Mapping the chemical chromatin reactivation landscape identifies BRD4-TAF1 cross-talk. Nature Chemical Biology 12(7), 504-510 (2016). |
