For research use only. Not for therapeutic Use.
Centaureidin(Cat No.:M084244) is a naturally occurring flavonoid found in various plants, including those of the Centaurea genus. It is classified as an O-methylated flavone, which contributes to its strong antioxidant properties. Centaureidin is of interest for its diverse pharmacological activities; it exhibits anti-inflammatory, antiviral, and anticancer properties, making it a focus of study in therapeutic research. Additionally, it has been noted for its potential in treating neurological disorders due to its ability to modulate enzyme activities and signaling pathways associated with inflammation and oxidative stress in neuronal cells.
CAS Number | 17313-52-9 |
Molecular Formula | C18H16O8 |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,6-dimethoxychromen-4-one |
InChI | InChI=1S/C18H16O8/c1-23-11-5-4-8(6-9(11)19)16-18(25-3)15(22)13-12(26-16)7-10(20)17(24-2)14(13)21/h4-7,19-21H,1-3H3 |
InChIKey | BZXULYMZYPRZOG-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(O2)C=C(C(=C3O)OC)O)OC)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |