For research use only. Not for therapeutic Use.
Centrinone (CAT: I002335) is a selective and reversible inhibitor of polo-like kinase 4 (Plk4). Plk4 is a serine-threonine protein kinase that plays a crucial role in initiating centriole/centrosome assembly, which is essential for proper cell division. By inhibiting Plk4, centrinone disrupts centriole formation and leads to the loss of centrosomes and primary cilia in cells. This selective depletion of centrosomes can have important implications in studying cell division processes and has potential applications in cancer research and therapy.
| Catalog Number | I002335 |
| CAS Number | 1798871-30-3 |
| Synonyms | LCR-263; Centrinone |
| Molecular Formula | C26H25F2N7O6S2 |
| Purity | ≥95% |
| Target | Polo-like Kinase (PLK) |
| Solubility | DMSO: ≥ 31 mg/mL |
| Storage | -20°C |
| IUPAC Name | 2-[2-fluoro-4-[(2-fluoro-3-nitrophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-N-(5-methyl-1H-pyrazol-3-yl)-6-morpholin-4-ylpyrimidin-4-amine |
| InChI | InChI=1S/C26H25F2N7O6S2/c1-15-12-21(33-32-15)29-24-23(40-2)25(34-8-10-41-11-9-34)31-26(30-24)42-20-7-6-17(13-18(20)27)43(38,39)14-16-4-3-5-19(22(16)28)35(36)37/h3-7,12-13H,8-11,14H2,1-2H3,(H2,29,30,31,32,33) |
| InChIKey | HHJSKDRCUMVWKF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1)NC2=NC(=NC(=C2OC)N3CCOCC3)SC4=C(C=C(C=C4)S(=O)(=O)CC5=C(C(=CC=C5)[N+](=O)[O-])F)F |
