For research use only. Not for therapeutic Use.
CEP03 (CAT: I024374) is a compound that exhibits the ability to enhance the proliferation of endothelial cells (EC) and endothelial progenitor cells (EPC). Additionally, CEP03 has been found to promote tubelike formation and wound-healing efficiency in these cells. These effects contribute to the stimulation of angiogenesis, the process of forming new blood vessels, which is crucial for tissue repair and recovery. In experimental studies involving mice with ischemic hind limbs, CEP03 demonstrated a significant improvement in blood flow perfusion recovery.
| Catalog Number | I024374 |
| CAS Number | 408309-29-5 |
| Synonyms | CEP-03; CEP 03; CEP03 |
| Molecular Formula | C7H9NO2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 3-(1H-Pyrrol-2-yl)propanoic acid |
| InChI | InChI=1S/C7H9NO2/c9-7(10)4-3-6-2-1-5-8-6/h1-2,5,8H,3-4H2,(H,9,10) |
| InChIKey | XDNDSAQVXNZKGP-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC1=CC=CN1 |
