For research use only. Not for therapeutic Use.
Cepharanthine（Cat No.:R054748）is a bisbenzylisoquinoline alkaloid derived from Stephania cepharantha, a plant traditionally used in Eastern medicine. It exhibits a wide range of pharmacological effects, including anti-inflammatory, immunomodulatory, and antioxidant properties. Cepharanthine has shown potential in treating conditions such as cancer, viral infections, and autoimmune diseases. It functions by modulating immune responses, inhibiting cell proliferation, and preventing oxidative damage. Research suggests that Cepharanthine may enhance the efficacy of conventional therapies, making it a promising candidate in the development of novel therapeutic strategies for various diseases.
| CAS Number | 481-49-2 |
| Synonyms | O-Methylcepharanoline;NSC 623442 |
| Molecular Formula | C37H38N2O6 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Storage | -20°C |
| IUPAC Name | (14S,27R)-22,33-dimethoxy-13,28-dimethyl-2,5,7,20-tetraoxa-13,28-diazaoctacyclo[25.6.2.216,19.13,10.121,25.04,8.031,35.014,39]nonatriaconta-1(33),3(39),4(8),9,16(38),17,19(37),21,23,25(36),31,34-dodecaene |
| InChI | InChI=1S/C37H38N2O6/c1-38-13-11-24-18-31(41-4)33-20-27(24)28(38)16-23-7-10-30(40-3)32(17-23)44-26-8-5-22(6-9-26)15-29-35-25(12-14-39(29)2)19-34-36(37(35)45-33)43-21-42-34/h5-10,17-20,28-29H,11-16,21H2,1-4H3/t28-,29+/m1/s1 |
| InChIKey | YVPXVXANRNDGTA-WDYNHAJCSA-N |
| SMILES | CN1CCC2=CC3=C(C4=C2[C@@H]1CC5=CC=C(C=C5)OC6=C(C=CC(=C6)C[C@@H]7C8=CC(=C(C=C8CCN7C)OC)O4)OC)OCO3 |
