For research use only. Not for therapeutic Use.
Cereblon inhibitor 1, an isoindoline derivative, is a cereblon E3 ubiquitin ligase modulating agent. Cereblon inhibitor 1 has the potential for cancer research.
Cereblon inhibitor 1 (compound CM-48) suppresses MM.1S cell proliferation (IC50=0.0365 nM)[1].
| Catalog Number | I044074 |
| CAS Number | 2672489-14-2 |
| Synonyms | 2-chloro-4-[4-[[4-[[2-[(3S)-2,6-dioxopiperidin-3-yl]-1-oxo-3H-isoindol-4-yl]oxymethyl]-3-fluorophenyl]methyl]piperazin-1-yl]-3-fluorobenzonitrile |
| Molecular Formula | C32H28ClF2N5O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C32H28ClF2N5O4/c33-29-20(15-36)6-7-25(30(29)35)39-12-10-38(11-13-39)16-19-4-5-21(24(34)14-19)18-44-27-3-1-2-22-23(27)17-40(32(22)43)26-8-9-28(41)37-31(26)42/h1-7,14,26H,8-13,16-18H2,(H,37,41,42)/t26-/m0/s1 |
| InChIKey | PVJLGFCYPTZLAE-SANMLTNESA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC=C3OCC4=C(C=C(C=C4)CN5CCN(CC5)C6=C(C(=C(C=C6)C#N)Cl)F)F |
| Reference | [1]. Hui Liu, et al. Isoindoline derivative and its application. WO2021147889A1. |
