For research use only. Not for therapeutic Use.
Cereblon inhibitor 2（Cat No.:I041082）is a small molecule that specifically targets and inhibits cereblon, a protein involved in regulating protein homeostasis and modulating the immune response. By disrupting cereblon’s activity, this inhibitor can interfere with the function of E3 ubiquitin ligase complexes, affecting protein degradation and cellular processes such as immune modulation and cancer progression. Preclinical studies suggest that cereblon inhibitor 2 may have potential in treating cancers, particularly hematological malignancies, and autoimmune diseases. Its ability to precisely modulate protein degradation pathways makes it a promising candidate for targeted therapeutic interventions.
| CAS Number | 2639380-62-2 |
| Synonyms | 1-(3-chloro-4-methylphenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]urea |
| Molecular Formula | C22H21ClN4O4 |
| Purity | ≥95% |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]urea |
| InChI | InChI=1S/C22H21ClN4O4/c1-12-2-5-15(9-17(12)23)25-22(31)24-10-13-3-4-14-11-27(21(30)16(14)8-13)18-6-7-19(28)26-20(18)29/h2-5,8-9,18H,6-7,10-11H2,1H3,(H2,24,25,31)(H,26,28,29) |
| InChIKey | JZFGEKDBVDHOTP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)NCC2=CC3=C(CN(C3=O)C4CCC(=O)NC4=O)C=C2)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
