Cereblon Modulator 1 (CC-1) (Cat.No:I016939) is a small molecule compound that selectively binds to cereblon, a protein involved in the ubiquitin-proteasome system. By modulating cereblon activity, CC-1 has the potential to regulate the degradation of certain proteins and alter cellular processes. CC-1 has been investigated for its therapeutic potential in various diseases, including cancer and autoimmune disorders. However, further studies are needed to fully elucidate its mechanism of action and evaluate its clinical efficacy.
| Catalog Number | I016939 |
| CAS Number | 1860875-51-9 |
| Molecular Formula | C₂₂H₁₈ClF₂N₃O₄ |
| Purity | ≥95% |
| IUPAC Name | 2-(4-chlorophenyl)-N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]-2,2-difluoroacetamide |
| InChI | InChI=1S/C22H18ClF2N3O4/c23-15-4-2-14(3-5-15)22(24,25)21(32)26-10-12-1-6-16-13(9-12)11-28(20(16)31)17-7-8-18(29)27-19(17)30/h1-6,9,17H,7-8,10-11H2,(H,26,32)(H,27,29,30) |
| InChIKey | PWBHUSLMHZLGRN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC(=C3)CNC(=O)C(C4=CC=C(C=C4)Cl)(F)F |
| Reference | [1]. Ellen Filvaroff, et al. Methods for treating cancer and the use of biomarkers as a predictor of clinical sensitivity to therapies. WO2017120446A1.<br>[2]. CC-90009 |
