For research use only. Not for therapeutic Use.
Cerebroside B(Cat No.:R064264)is a glycosphingolipid found in the nervous tissue of various organisms. It consists of a ceramide backbone linked to a sugar moiety, typically glucose or galactose. As a component of the myelin sheath, Cerebroside B plays a crucial role in maintaining the structural integrity of nerve cells and in facilitating proper nerve function. It is also involved in cellular signaling, lipid metabolism, and cell recognition processes. Its study has implications in neurological diseases, especially those involving demyelination and lipid metabolism disorders.
CAS Number | 88642-46-0 |
Molecular Formula | C41H77NO9 |
Purity | ≥95% |
Target | Fungal |
Storage | -20°C |
IUPAC Name | (2R)-2-hydroxy-N-[(2S,3R,4E,8E)-3-hydroxy-9-methyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctadeca-4,8-dien-2-yl]hexadecanamide |
InChI | InChI=1S/C41H77NO9/c1-4-6-8-10-12-13-14-15-16-18-20-24-29-35(45)40(49)42-33(31-50-41-39(48)38(47)37(46)36(30-43)51-41)34(44)28-25-21-23-27-32(3)26-22-19-17-11-9-7-5-2/h25,27-28,33-39,41,43-48H,4-24,26,29-31H2,1-3H3,(H,42,49)/b28-25+,32-27+/t33-,34+,35+,36+,37+,38-,39+,41+/m0/s1 |
InChIKey | YBSQGNFRWZKFMJ-FRJHFHMPSA-N |
SMILES | CCCCCCCCCCCCCC[C@H](C(=O)N[C@@H](CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)[C@@H](/C=C/CC/C=C(\C)/CCCCCCCCC)O)O |