For research use only. Not for therapeutic Use.
Cesium Carbonate is a high-purity compound essential for advanced pharmaceutical and chemical research. This cesium salt is crucial for studies involving organic synthesis, catalysis, and as a base in various reactions. Known for its stability and reactivity, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in diverse scientific applications.
Catalog Number | R021103 |
CAS Number | 534-17-8 |
Synonyms | Carbonic Acid Dicesium Salt; Cesium Carbonate (Cs2CO3); Cesium Carbonate; Dicesium Carbonate; |
Molecular Formula | Cs2CO3 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | dicesium;carbonate |
InChI | InChI=1S/CH2O3.2Cs/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2 |
InChIKey | FJDQFPXHSGXQBY-UHFFFAOYSA-L |
SMILES | C(=O)([O-])[O-].[Cs+].[Cs+] |