For research use only. Not for therapeutic Use.
Cetirizine 2-Chloro Impurity Dihydrochloride(CAT: R048712) is a chemical derivative associated with the antihistamine drug cetirizine. This compound is often encountered in pharmaceutical research and development as it represents an impurity that can be formed during the synthesis of cetirizine or related pharmaceuticals.
| CAS Number | 83881-59-8 |
| Synonyms | 2-[2-[4-[(2-Chlorophenyl)phenylmethyl]-1-piperazinyl]ethoxy]acetic Acid Hydrochloride; Cetirizine Imp. C (EP); |
| Molecular Formula | C21H25ClN2O3 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | -20°C |
| IUPAC Name | 2-[2-[4-[(2-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid |
| InChI | InChI=1S/C21H25ClN2O3/c22-19-9-5-4-8-18(19)21(17-6-2-1-3-7-17)24-12-10-23(11-13-24)14-15-27-16-20(25)26/h1-9,21H,10-16H2,(H,25,26) |
| InChIKey | AMWZYEYIOPBLEO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=CC=C3Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
