For research use only. Not for therapeutic Use.
Cetirizine D8 dihydrochloride（Cat No.:C000840） is the deuterated form of cetirizine, a second-generation antihistamine derived from hydroxyzine. Acting as a specific, orally active, long-acting H1 receptor antagonist, cetirizine exerts potent antiallergic properties and inhibits eosinophil chemotaxis during allergic reactions. Its efficacy in relieving allergy symptoms, such as sneezing, itching, and runny nose, is widely used to manage allergic conditions like hay fever and hives. Cetirizine D8 dihydrochloride’s deuterated structure allows for accurate isotope tracking in pharmacokinetic and metabolic studies, aiding researchers in understanding its behavior and potential applications in personalized medicine approaches for allergic diseases.
| Catalog Number | C000840 |
| CAS Number | 2070015-04-0 |
| Synonyms | 2-[4-[(4-Chlorophenyl)-phenylmethyl]-1-piperazinyl-d8]ethoxy]acetic Acid; |
| Molecular Formula | C₂₁H₁₉D₈Cl₃N₂O₃ |
| Purity | ≥95% |
| Solubility | Methanol (Slightly), Water (Slightly) |
| Appearance | White to Pale Yellow Solid |
| Storage | -20°C, Hygroscopic |
| IUPAC Name | 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]ethoxy]acetic acid;dihydrochloride |
| InChI | InChI=1S/C21H25ClN2O3.2ClH/c22-19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)24-12-10-23(11-13-24)14-15-27-16-20(25)26;;/h1-9,21H,10-16H2,(H,25,26);2*1H/i10D2,11D2,12D2,13D2;; |
| InChIKey | PGLIUCLTXOYQMV-FLZNRFFQSA-N |
| SMILES | C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl.Cl.Cl |
| Reference | De Vos, C., et al.: Ann. Allergy, 59, 278 (1987), Juhlin, L., et al.: J. Allergy Clin. Immunol., 80, 599 (1987), Fadel, R., et al.: Clin. Allergy, 17, 373 (1987), Gengo, F.M., et al.: Clin. Pharmacol. Ther., 42, 265 (1987) |
