For research use only. Not for therapeutic Use.
Cetirizine(CAT: I005021) is a medication used as an antihistamine to treat allergic reactions such as hay fever, hives, and allergic rhinitis. It works by blocking the action of histamine, a substance produced by the body in response to an allergic reaction, which causes symptoms such as itching, sneezing, runny nose, and watery eyes.
| Catalog Number | I005021 |
| CAS Number | 83881-51-0 |
| Synonyms | 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid |
| Molecular Formula | C21H25ClN2O3 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | 10 mM in DMSO ; water:1000 mg/ml |
| Storage | Store at -20°C |
| IUPAC Name | 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid |
| InChI | 1S/C21H25ClN2O3/c22-19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)24-12-10-23(11-13-24)14-15-27-16-20(25)26/h1-9,21H,10-16H2,(H,25,26) |
| InChIKey | ZKLPARSLTMPFCP-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl |
