For research use only. Not for therapeutic Use.
Cetotiamine(Cat No.:M067988), also known as thiamine, is a derivative of thiamine (vitamin B1) with a sulfur atom substituted for one of the nitrogen atoms in the thiazole ring. This modification enhances its lipid solubility compared to thiamine, facilitating its absorption into cell membranes. Cetotiamine is primarily used as a neuroprotective agent and a modulator of cerebral energy metabolism. It has been studied for its potential therapeutic benefits in various neurological disorders, including Alzheimer’s disease, Parkinson’s disease, and ischemic stroke. Additionally, cetotiamine exhibits antioxidant properties, which may contribute to its neuroprotective effects.
CAS Number | 137-76-8 |
Molecular Formula | C18H26N4O6S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | ethyl [(Z)-2-[(4-amino-2-methylpyrimidin-5-yl)methyl-formylamino]-5-ethoxycarbonyloxypent-2-en-3-yl]sulfanylformate |
InChI | InChI=1S/C18H26N4O6S/c1-5-26-17(24)28-8-7-15(29-18(25)27-6-2)12(3)22(11-23)10-14-9-20-13(4)21-16(14)19/h9,11H,5-8,10H2,1-4H3,(H2,19,20,21)/b15-12- |
InChIKey | YBROOZNJUDHTGE-QINSGFPZSA-N |
SMILES | CCOC(=O)OCCC(=C(C)N(CC1=CN=C(N=C1N)C)C=O)SC(=O)OCC |