For research use only. Not for therapeutic Use.
Cetyl chloroformate (CAT: L000244) is a compound mainly used in organic chemistry. It functions as an acyl chloride and plays a pivotal role in various organic reactions, including acylation. In organic chemistry, it serves as a reagent for the synthesis of esters and other organic compounds, contributing to the creation of a wide range of chemical structures.
CAS Number | 26272-90-2 |
Molecular Formula | C17H33ClO2 |
Purity | ≥95% |
IUPAC Name | hexadecyl carbonochloridate |
InChI | InChI=1S/C17H33ClO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-17(18)19/h2-16H2,1H3 |
InChIKey | HOQUWXSARQBQCW-UHFFFAOYSA-N |