For research use only. Not for therapeutic Use.
CFTR Corrector 8（Cat No.:I042763）is a small molecule compound designed to target and correct the misfolded cystic fibrosis transmembrane conductance regulator (CFTR) protein, which causes cystic fibrosis when mutated. CFTR Corrector 8 works by stabilizing the protein and promoting its proper folding and trafficking to the cell surface, restoring its chloride ion channel function. This corrector is part of a class of drugs aimed at improving the function of defective CFTR in patients with cystic fibrosis. Ongoing research is focused on evaluating its effectiveness, safety, and potential in combination therapies for cystic fibrosis.
| CAS Number | 1918142-35-4 |
| Synonyms | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-N-[(2S,4S)-2-(3,4-dimethoxyphenyl)-7-methoxy-3,4-dihydro-2H-chromen-4-yl]cyclopropane-1-carboxamide |
| Molecular Formula | C29H27F2NO7 |
| Purity | ≥95% |
| IUPAC Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-N-[(2S,4S)-2-(3,4-dimethoxyphenyl)-7-methoxy-3,4-dihydro-2H-chromen-4-yl]cyclopropane-1-carboxamide |
| InChI | InChI=1S/C29H27F2NO7/c1-34-18-6-7-19-20(15-23(37-24(19)14-18)16-4-8-21(35-2)25(12-16)36-3)32-27(33)28(10-11-28)17-5-9-22-26(13-17)39-29(30,31)38-22/h4-9,12-14,20,23H,10-11,15H2,1-3H3,(H,32,33)/t20-,23-/m0/s1 |
| InChIKey | KDOQEEMQPHIANX-REWPJTCUSA-N |
| SMILES | COC1=CC2=C(C=C1)[C@H](C[C@H](O2)C3=CC(=C(C=C3)OC)OC)NC(=O)C4(CC4)C5=CC6=C(C=C5)OC(O6)(F)F |
