For research use only. Not for therapeutic Use.
CG347B (Cat No.:I016201) is a selective inhibitor of histone deacetylase 6 (HDAC6), an enzyme involved in the regulation of protein acetylation and cellular processes. By targeting HDAC6, CG347B specifically modulates the deacetylation of proteins, leading to altered protein-protein interactions, cellular functions, and gene expression. This selective inhibition of HDAC6 has been shown to have potential therapeutic applications, particularly in diseases where HDAC6 dysregulation is implicated, such as cancer and neurodegenerative disorders.
| Catalog Number | I016201 |
| CAS Number | 1598426-03-9 |
| Molecular Formula | C₁₆H₁₇N₃O₂ |
| Purity | ≥95% |
| IUPAC Name | ethyl 2-[(1-phenylcyclopropyl)amino]pyrimidine-5-carboxylate |
| InChI | InChI=1S/C16H17N3O2/c1-2-21-14(20)12-10-17-15(18-11-12)19-16(8-9-16)13-6-4-3-5-7-13/h3-7,10-11H,2,8-9H2,1H3,(H,17,18,19) |
| InChIKey | CTTSUGRYXUPYIO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N=C1)NC2(CC2)C3=CC=CC=C3 |
| Reference | [1]. Christopher M. YATES. Metalloenzyme inhibitor compounds. WO2018165520A1. |
