CGI-1746（Cat No.:I005423）is a potent and selective inhibitor of Bruton’s tyrosine kinase (BTK), a key enzyme involved in B-cell receptor signaling. By inhibiting BTK, CGI-1746 disrupts the activation of pathways that promote the survival, proliferation, and differentiation of B-cells. This makes it a promising therapeutic candidate for treating B-cell-related malignancies such as chronic lymphocytic leukemia (CLL) and autoimmune diseases like rheumatoid arthritis. CGI-1746 has shown efficacy in preclinical models by reducing inflammation and immune response, offering potential in targeting conditions driven by abnormal B-cell activation.
| Catalog Number | I005423 |
| CAS Number | 910232-84-7 |
| Synonyms | CGI1746 |
| Molecular Formula | C₃₄H₃₇N₅O₄ |
| Purity | ≥95% |
| Target | BTK |
| Solubility | in DMSO > 10 mM |
| Storage | Store at -20°C |
| IUPAC Name | 4-tert-butyl-N-[2-methyl-3-[4-methyl-6-[4-(morpholine-4-carbonyl)anilino]-5-oxopyrazin-2-yl]phenyl]benzamide |
| InChI | InChI=1S/C34H37N5O4/c1-22-27(7-6-8-28(22)37-31(40)23-9-13-25(14-10-23)34(2,3)4)29-21-38(5)33(42)30(36-29)35-26-15-11-24(12-16-26)32(41)39-17-19-43-20-18-39/h6-16,21H,17-20H2,1-5H3,(H,35,36)(H,37,40) |
| InChIKey | JIFCFQDXHMUPGP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1NC(=O)C2=CC=C(C=C2)C(C)(C)C)C3=CN(C(=O)C(=N3)NC4=CC=C(C=C4)C(=O)N5CCOCC5)C |
| Reference | [1]. Di Paolo, Julie A. et al. Specific Btk inhibition suppresses B cell- and myeloid cell-mediated arthritis. Nature Chemical Biology (2011), 7(1), 41-50 |
