For research use only. Not for therapeutic Use.
CGM 097 sulfate(CAT: R032003) is a chemical compound that belongs to the class of small molecules known as murine double minute 2 (MDM2) inhibitors. Its mode of action involves specifically targeting the MDM2 protein, which plays a crucial role in the regulation of the tumor suppressor protein p53. By inhibiting MDM2, CGM 097 sulfate can potentially lead to the activation and stabilization of p53, a key factor in controlling cell cycle arrest and apoptosis. Pharmacologically, CGM 097 sulfate holds promise as a candidate for cancer therapy, particularly in malignancies where the p53 pathway is disrupted. Its applications lie in the field of oncology, as a potential therapeutic agent for restoring p53 function and inhibiting cancer cell growth.
CAS Number | 1313367-56-4 |
Synonyms | (1S)-1-(4-Chlorophenyl)-1,4-dihydro-6-methoxy-7-(1-methylethoxy)-2-[4-[methyl[[trans-4-(4-methyl-3-oxo-1-piperazinyl)cyclohexyl]methyl]amino]phenyl]-3(2H)-Isoquinolinone Sulfate; |
Molecular Formula | C₃₈H₄₇ClN₄O₄•H₂SO₄ |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | -20°C |
IUPAC Name | (1S)-1-(4-chlorophenyl)-6-methoxy-2-[4-[methyl-[[4-(4-methyl-3-oxopiperazin-1-yl)cyclohexyl]methyl]amino]phenyl]-7-propan-2-yloxy-1,4-dihydroisoquinolin-3-one;sulfuric acid |
InChI | 1S/C38H47ClN4O4.H2O4S/c1-25(2)47-35-22-33-28(20-34(35)46-5)21-36(44)43(38(33)27-8-10-29(39)11-9-27)32-16-14-30(15-17-32)41(4)23-26-6-12-31(13-7-26)42-19-18-40(3)37(45)24-42;1-5(2,3)4/h8-11,14-17,20,22,25-26,31,38H,6-7,12-13,18-19,21,23-24H2,1-5H3;(H2,1,2,3,4)/t26?,31?,38-;/m0./s1 |
InChIKey | YFLKIFVIZIALIA-GHVGLMRRSA-N |
SMILES | CC(C)OC1=C(C=C2CC(=O)N([C@H](C2=C1)C3=CC=C(C=C3)Cl)C4=CC=C(C=C4)N(C)CC5CCC(CC5)N6CCN(C(=O)C6)C)OC.OS(=O)(=O)O |