For research use only. Not for therapeutic Use.
CGP 78608 hydrochloride (CAT: I010418) is a potent and selective antagonist of the N-methyl-D-aspartate (NMDA) receptor. By specifically targeting the NMDA receptor, CGP 78608 hydrochloride blocks the binding of glutamate, an excitatory neurotransmitter, and prevents excessive activation of the receptor. This antagonist activity leads to the modulation of NMDA receptor-mediated neurotransmission, which plays a crucial role in synaptic plasticity, learning, and memory. CGP 78608 hydrochloride has shown potential in preclinical studies as a therapeutic agent for neurological disorders associated with NMDA receptor dysregulation, such as Alzheimer’s disease, epilepsy, and neuropathic pain. Its selectivity and potency make it a promising candidate for further research and development in these areas.
| Catalog Number | I010418 |
| CAS Number | 1135278-54-4 |
| Synonyms | Alternative Name: PAMQX |
| Molecular Formula | C11H14BrClN3O5P |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble to 100 mM in 2.2eq. NaOH |
| Storage | Store at RT |
| Related CAS | 206648-13-7(free base) |
| IUPAC Name | [(1S)-1-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]ethyl]phosphonic acid;hydrochloride |
| InChI | InChI=1S/C11H13BrN3O5P.ClH/c1-5(21(18,19)20)13-4-6-2-7(12)3-8-9(6)15-11(17)10(16)14-8;/h2-3,5,13H,4H2,1H3,(H,14,16)(H,15,17)(H2,18,19,20);1H/t5-;/m0./s1 |
| InChIKey | MZQQZBPMRPDKTB-JEDNCBNOSA-N |
| SMILES | CC(NCC1=CC(=CC2=C1NC(=O)C(=O)N2)Br)P(=O)(O)O.Cl |
