For research use only, not for therapeutic use.
CGS 21680 HCl（Cat No.:I000969）is a potent agonist of the adenosine A2 receptor. With an IC50 value of 22 nM, it demonstrates high affinity for the A2 receptor subtype. Importantly, CGS 21680 HCl exhibits a significant selectivity for the A2 receptor over the A1 receptor, with a 140-fold difference in potency. This selectivity is crucial for specific modulation of A2 receptor-mediated signaling pathways, enabling researchers to investigate the functional roles and therapeutic potential of the adenosine A2 receptor in various physiological and pathological conditions.
| Catalog Number | I000969 |
| CAS Number | 124431-80-7 |
| Synonyms | 3-[4-[2-[[6-amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]amino]ethyl]phenyl]propanoic acid;hydrochloride |
| Molecular Formula | C23H29N7O6 • HCl |
| Purity | ≥95% |
| Target | Adenosine Receptor |
| Solubility | DMSO: ≥ 20 mg/mL |
| Storage | 2-8°C |
| IC50 | 22 nM |
| IUPAC Name | 3-[4-[2-[[6-amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]amino]ethyl]phenyl]propanoic acid;hydrochloride |
| InChI | InChI=1S/C23H29N7O6.ClH/c1-2-25-21(35)18-16(33)17(34)22(36-18)30-11-27-15-19(24)28-23(29-20(15)30)26-10-9-13-5-3-12(4-6-13)7-8-14(31)32;/h3-6,11,16-18,22,33-34H,2,7-10H2,1H3,(H,25,35)(H,31,32)(H3,24,26,28,29);1H/t16-,17+,18-,22+;/m0./s1 |
| InChIKey | QPHVMNOEKKJYJO-MJWSIIAUSA-N |
| SMILES | CCNC(=O)[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=C(N=C32)NCCC4=CC=C(C=C4)CCC(=O)O)N)O)O.Cl |
| Reference | <p style=/line-height:25px/> |
