CGS 21680（Cat No.:I000745） is a potent adenosine A2 receptor agonist that has an IC50 value of 22 nM. It exhibits a 140-fold selectivity over the adenosine A1 receptor. As an A2 receptor agonist, CGS 21680 specifically activates the adenosine A2 receptor subtype, leading to downstream signaling events associated with this receptor. The high selectivity of CGS 21680 for the A2 receptor makes it a valuable tool in studying the functions and mechanisms of A2 receptor-mediated pathways.
| Catalog Number | I000745 |
| CAS Number | 120225-54-9 |
| Synonyms | 3-[4-[2-[[6-amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]amino]ethyl]phenyl]propanoic acid |
| Molecular Formula | C23H29N7O6 |
| Purity | ≥95% |
| Target | Adenosine Receptor |
| Solubility | 10 mM in DMSO |
| Storage | 2–8 °C |
| IC50 | 22 nM |
| IUPAC Name | 3-[4-[2-[[6-amino-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purin-2-yl]amino]ethyl]phenyl]propanoic acid |
| InChI | InChI=1S/C23H29N7O6/c1-2-25-21(35)18-16(33)17(34)22(36-18)30-11-27-15-19(24)28-23(29-20(15)30)26-10-9-13-5-3-12(4-6-13)7-8-14(31)32/h3-6,11,16-18,22,33-34H,2,7-10H2,1H3,(H,25,35)(H,31,32)(H3,24,26,28,29)/t16-,17+,18-,22+/m0/s1 |
| InChIKey | PAOANWZGLPPROA-RQXXJAGISA-N |
| SMILES | CCNC(=O)C1C(C(C(O1)N2C=NC3=C(N=C(N=C32)NCCC4=CC=C(C=C4)CCC(=O)O)N)O)O |
| Reference | <p style=/line-height:25px/> |
