For research use only. Not for therapeutic Use.
CH5138303（Cat No.:I006086）is a selective small molecule inhibitor of the JAK2 (Janus kinase 2) enzyme, which plays a key role in cytokine signaling and is involved in hematopoiesis. JAK2 mutations are often implicated in various hematologic disorders, including myeloproliferative diseases like polycythemia vera and essential thrombocythemia. By inhibiting JAK2, CH5138303 suppresses abnormal cell proliferation and reduces disease-related symptoms. This compound is being investigated as a potential therapeutic for JAK2-driven diseases, offering a targeted treatment approach to manage conditions associated with excessive hematopoietic cell production and related complications.
| CAS Number | 959763-06-5 |
| Synonyms | 4-[[4-amino-6-(7-chloro-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-8-yl)-1,3,5-triazin-2-yl]sulfanyl]butanamide |
| Molecular Formula | C19H18ClN5O2S |
| Purity | ≥95% |
| IUPAC Name | 4-[[4-amino-6-(7-chloro-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-8-yl)-1,3,5-triazin-2-yl]sulfanyl]butanamide |
| InChI | InChI=1S/C19H18ClN5O2S/c20-13-7-11-9-27-8-10-3-1-4-12(15(10)11)16(13)17-23-18(22)25-19(24-17)28-6-2-5-14(21)26/h1,3-4,7H,2,5-6,8-9H2,(H2,21,26)(H2,22,23,24,25) |
| InChIKey | VIGHQZSTZWNWFA-UHFFFAOYSA-N |
| SMILES | C1C2=C3C(=CC(=C(C3=CC=C2)C4=NC(=NC(=N4)SCCCC(=O)N)N)Cl)CO1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
