For research use only. Not for therapeutic Use.
Chaetochromin C(CAT: I024510) is a mycotoxin derived from Chaetomium species, belonging to the class of azaphilones. This compound exhibits diverse biological activities, including antifungal, antibacterial, and cytotoxic properties, making it a valuable tool in natural product and pharmacological research. Chaetochromin C is commonly studied for its potential in exploring novel therapeutic agents and understanding toxin-related mechanisms in microbial interactions. With its complex chemical structure and bioactivity, Chaetochromin C supports advanced studies in microbiology, biochemistry, and drug discovery, offering insights into its role in natural defense mechanisms and potential biomedical applications.
| Catalog Number | I024510 |
| CAS Number | 108906-68-9 |
| Synonyms | Chaetochromin C; UNII-IXY515E9BM |
| Molecular Formula | C29H24O10 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (2R,3R)-5,6,8-trihydroxy-2,3-dimethyl-9-[(2R)-5,6,8-trihydroxy-2-methyl-4-oxo-2,3-dihydrobenzo[g]chromen-9-yl]-2,3-dihydrobenzo[g]chromen-4-o |
| InChI | InChI=1S/C29H24O10/c1-9-4-14(30)25-19(38-9)5-12-21(15(31)7-17(33)23(12)28(25)36)22-13-6-20-26(27(35)10(2)11(3)39-20)29(37)24(13)18(34)8-16(22)32/h5-11,31-34,36-37H,4H2,1-3H3/t9-,10-,11-/m1/s1 |
| InChIKey | ZHECJFNKDQXHIW-GMTAPVOTSA-N |
| SMILES | C[C@@H]1CC(=O)C2=C(O1)C=C3C(=C2O)C(=CC(=C3C4=C(C=C(C5=C(C6=C(C=C54)O[C@@H]([C@H](C6=O)C)C)O)O)O)O)O |
