For research use only. Not for therapeutic Use.
Chalcone dibromide(CAT: I040739) is a synthetic derivative of the chalcone family, characterized by two bromine atoms on its aromatic rings, enhancing its bioactivity. Known for its broad-spectrum pharmacological potential, chalcone dibromide exhibits notable anticancer, anti-inflammatory, and antimicrobial properties. It acts by modulating key signaling pathways such as NF-κB and MAPK, and may also disrupt tubulin polymerization, leading to cell cycle arrest and apoptosis in cancer cells. Chalcone dibromide is widely used in medicinal chemistry and drug discovery research to explore structure-activity relationships and novel therapeutic mechanisms. It is suitable for in vitro studies in oncology and inflammation models.
| CAS Number | 611-91-6 |
| Synonyms | 2,3-dibromo-1,3-diphenylpropan-1-one |
| Molecular Formula | C15H12Br2O |
| Purity | ≥95% |
| IUPAC Name | 2,3-dibromo-1,3-diphenylpropan-1-one |
| InChI | InChI=1S/C15H12Br2O/c16-13(11-7-3-1-4-8-11)14(17)15(18)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey | LYAGBKGGYRLVTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(C(=O)C2=CC=CC=C2)Br)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
