For research use only. Not for therapeutic Use.
Chalcone dibromide is a useful synthon in the synthesis of a large number of bioactive molecules such as pyrazolines, hydroxy pyrazolines, isoxazoles etc. Chalcone dibromide possesses antioxidant effects against tumor cells by inhibiting superoxide production and lipid peroxidation. Chalcone dibromide can be used for cancer disease research[1].
CAS Number | 611-91-6 |
Synonyms | 2,3-dibromo-1,3-diphenylpropan-1-one |
Molecular Formula | C15H12Br2O |
Purity | ≥95% |
InChI | InChI=1S/C15H12Br2O/c16-13(11-7-3-1-4-8-11)14(17)15(18)12-9-5-2-6-10-12/h1-10,13-14H |
InChIKey | LYAGBKGGYRLVTR-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C(C(C(=O)C2=CC=CC=C2)Br)Br |
Reference | [1]. Rammohan, A., et al. Chalcone synthesis, properties and medicinal applications: a review. Environ Chem Lett 18, 433–458 (2020). |