For research use only. Not for therapeutic Use.
Chalcone(Cat No.:R024448) is a natural flavonoid compound found in various plants. Its mode of action involves serving as a precursor in the biosynthesis of many other flavonoids and related compounds. Pharmacologically, chalcone has shown various biological activities, including antioxidant, anti-inflammatory, and anticancer effects. It exhibits these properties through multiple mechanisms, such as scavenging free radicals, modulating inflammatory pathways, and inducing apoptosis in cancer cells. Chalcone has been studied for its potential therapeutic applications in various diseases, and it holds promise for drug development and as a lead compound for medicinal chemistry research.
CAS Number | 94-41-7 |
Synonyms | 1,3-Diphenyl-1-propen-3-one; 1,3-Diphenyl-2-propen-1-one; 1,3-Diphenyl-2-propenone; 1,3-Diphenyl-3-oxo-1-propene; 1,3-Diphenylpropen-3-one; 1,3-Diphenylpropenone; 1-Benzoyl-2-phenylethene; 1-Benzoyl-2-phenylethylene; 1-Phenyl-2-benzoylethylene; 2-Ben |
Molecular Formula | C₁₅H₁₂O |
Purity | ≥95% |
Target | Bacterial |
Storage | Store at -20°C |
IUPAC Name | (E)-1,3-diphenylprop-2-en-1-one |
InChI | InChI=1S/C15H12O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-12H/b12-11+ |
InChIKey | DQFBYFPFKXHELB-VAWYXSNFSA-N |
SMILES | C1=CC=C(C=C1)/C=C/C(=O)C2=CC=CC=C2 |