For research use only. Not for therapeutic Use.
Chamaechromone(CAT: R005581) is a naturally occurring flavonoid compound recognized for its potential biological activities and relevance in pharmaceutical and biochemical research. This dihydroxyflavone derivative exhibits antioxidant, anti-inflammatory, and potential anticancer properties, making it a valuable target for studying natural product pharmacology and therapeutic development. With its unique structural features, Chamaechromone serves as a key molecule in exploring flavonoid mechanisms, metabolic pathways, and drug interactions. Its high purity and consistency support advanced research in medicinal chemistry, drug discovery, and natural product synthesis, offering promising avenues for developing novel therapeutic agents.
CAS Number | 93413-00-4 |
Synonyms | 3-[1,1-bis(4-hydroxyphenyl)-3-oxo-3-(2,4,6-trihydroxyphenyl)propan-2-yl]-5,7-dihydroxychromen-4-one |
Molecular Formula | C30H22O10 |
Purity | ≥95% |
IUPAC Name | 3-[1,1-bis(4-hydroxyphenyl)-3-oxo-3-(2,4,6-trihydroxyphenyl)propan-2-yl]-5,7-dihydroxychromen-4-one |
InChI | InChI=1S/C30H22O10/c31-16-5-1-14(2-6-16)25(15-3-7-17(32)8-4-15)26(30(39)27-21(35)9-18(33)10-22(27)36)20-13-40-24-12-19(34)11-23(37)28(24)29(20)38/h1-13,25-26,31-37H |
InChIKey | KLKLIUIRQAMTAJ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)O)C(C3=COC4=CC(=CC(=C4C3=O)O)O)C(=O)C5=C(C=C(C=C5O)O)O)O |