For research use only. Not for therapeutic Use.
Chamigrenal is a natural compound found in chamomile flowers (Matricaria chamomilla). This compound contributes to chamomile’s characteristic aroma and exhibits various biological activities, including antioxidant and anti-inflammatory properties. Chamigrenal is of interest in the fragrance industry for its scent and potential therapeutic benefits. Its natural origin and aromatic properties make it valuable in perfumery and aromatherapy.
| Catalog Number | R072441 |
| CAS Number | 19912-84-6 |
| Molecular Formula | C15H22O |
| Purity | ≥95% |
| Target | Disease Research Fields |
| IUPAC Name | 5,5-dimethyl-1-methylidenespiro[5.5]undec-9-ene-9-carbaldehyde |
| InChI | InChI=1S/C15H22O/c1-12-5-4-8-14(2,3)15(12)9-6-13(11-16)7-10-15/h6,11H,1,4-5,7-10H2,2-3H3 |
| InChIKey | MJSPQLDLFYGVAU-UHFFFAOYSA-N |
| SMILES | CC1(CCCC(=C)C12CCC(=CC2)C=O)C |
